C21H25FO2S — CID 20806769
6-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-4-methoxyhexan-2-one (PubChem CID 20806769) has the molecular formula C21H25FO2S and a molecular weight of 360.49 g/mol. Its IUPAC name is 6-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-4-methoxyhexan-2-one.
| Compound Name | 6-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-4-methoxyhexan-2-one |
|---|---|
| PubChem CID | 20806769 |
| Molecular Formula | C21H25FO2S |
| Molecular Weight | 360.49 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 6-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-4-methoxyhexan-2-one |
| SMILES | COC(CCc1ccc(CCSc2ccc(F)cc2)cc1)CC(C)=O |
| InChI | InChI=1S/C21H25FO2S/c1-16(23)15-20(24-2)10-7-17-3-5-18(6-4-17)13-14-25-21-11-8-19(22)9-12-21/h3-6,8-9,11-12,20H,7,10,13-15H2,1-2H3 |
| InChIKey | WBRCSBFZIJUJFG-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.49 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |