C16H14F2O2S — CID 102533791
S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-4-phenylbutanethioate (PubChem CID 102533791) has the molecular formula C16H14F2O2S and a molecular weight of 308.35 g/mol. Its IUPAC name is S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-4-phenylbutanethioate.
| Compound Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-4-phenylbutanethioate |
|---|---|
| PubChem CID | 102533791 |
| Molecular Formula | C16H14F2O2S |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-4-phenylbutanethioate |
| SMILES | O=C(Sc1ccccc1F)[C@@H](F)[C@@H](O)Cc1ccccc1 |
| InChI | InChI=1S/C16H14F2O2S/c17-12-8-4-5-9-14(12)21-16(20)15(18)13(19)10-11-6-2-1-3-7-11/h1-9,13,15,19H,10H2/t13-,15-/m0/s1 |
| InChIKey | HUVLJGPIHDMGJR-ZFWWWQNUSA-N |
| XLogP | 3.39 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|