C21H21F5O2S — CID 20806767
4-methoxy-6-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-2-one (PubChem CID 20806767) has the molecular formula C21H21F5O2S and a molecular weight of 432.45 g/mol. Its IUPAC name is 4-methoxy-6-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-2-one.
| Compound Name | 4-methoxy-6-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-2-one |
|---|---|
| PubChem CID | 20806767 |
| Molecular Formula | C21H21F5O2S |
| Molecular Weight | 432.45 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | 4-methoxy-6-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-2-one |
| SMILES | COC(CCc1ccc(CCSc2c(F)c(F)c(F)c(F)c2F)cc1)CC(C)=O |
| InChI | InChI=1S/C21H21F5O2S/c1-12(27)11-15(28-2)8-7-13-3-5-14(6-4-13)9-10-29-21-19(25)17(23)16(22)18(24)20(21)26/h3-6,15H,7-11H2,1-2H3 |
| InChIKey | ASVFQCYIJJTYGG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.45 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|