C25H31FO4S — CID 20806759
[1-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-5-oxohexan-3-yl] 3-methoxybutanoate (PubChem CID 20806759) has the molecular formula C25H31FO4S and a molecular weight of 446.58 g/mol. Its IUPAC name is [1-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-5-oxohexan-3-yl] 3-methoxybutanoate.
| Compound Name | [1-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-5-oxohexan-3-yl] 3-methoxybutanoate |
|---|---|
| PubChem CID | 20806759 |
| Molecular Formula | C25H31FO4S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | [1-[4-[2-(4-fluorophenyl)sulfanylethyl]phenyl]-5-oxohexan-3-yl] 3-methoxybutanoate |
| SMILES | COC(C)CC(=O)OC(CCc1ccc(CCSc2ccc(F)cc2)cc1)CC(C)=O |
| InChI | InChI=1S/C25H31FO4S/c1-18(27)16-23(30-25(28)17-19(2)29-3)11-8-20-4-6-21(7-5-20)14-15-31-24-12-9-22(26)10-13-24/h4-7,9-10,12-13,19,23H,8,11,14-17H2,1-3H3 |
| InChIKey | BAOCVMZZTMGLBT-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |