C25H27F5O4S — CID 20806764
[5-oxo-1-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-3-yl] 3-methoxybutanoate (PubChem CID 20806764) has the molecular formula C25H27F5O4S and a molecular weight of 518.54 g/mol. Its IUPAC name is [5-oxo-1-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-3-yl] 3-methoxybutanoate.
| Compound Name | [5-oxo-1-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-3-yl] 3-methoxybutanoate |
|---|---|
| PubChem CID | 20806764 |
| Molecular Formula | C25H27F5O4S |
| Molecular Weight | 518.54 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | [5-oxo-1-[4-[2-(2,3,4,5,6-pentafluorophenyl)sulfanylethyl]phenyl]hexan-3-yl] 3-methoxybutanoate |
| SMILES | COC(C)CC(=O)OC(CCc1ccc(CCSc2c(F)c(F)c(F)c(F)c2F)cc1)CC(C)=O |
| InChI | InChI=1S/C25H27F5O4S/c1-14(31)12-18(34-19(32)13-15(2)33-3)9-8-16-4-6-17(7-5-16)10-11-35-25-23(29)21(27)20(26)22(28)24(25)30/h4-7,15,18H,8-13H2,1-3H3 |
| InChIKey | HOOLCBAEXNUPPI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|