C21H32O3SSi — CID 10023453
trans-(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]cyclopentan-1-one (PubChem CID 10023453) has the molecular formula C21H32O3SSi and a molecular weight of 392.64 g/mol. Its IUPAC name is trans-(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]cyclopentan-1-one.
| Compound Name | trans-(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 10023453 |
| Molecular Formula | C21H32O3SSi |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | trans-(3R,4R)-3-[tert-butyl(dimethyl)silyl]oxy-4-[(E)-3-methoxy-1-phenylsulfanylprop-2-enyl]cyclopentan-1-one |
| SMILES | CO/C=C/C(Sc1ccccc1)[C@@H]1CC(=O)C[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H32O3SSi/c1-21(2,3)26(5,6)24-19-15-16(22)14-18(19)20(12-13-23-4)25-17-10-8-7-9-11-17/h7-13,18-20H,14-15H2,1-6H3/b13-12+/t18-,19-,20?/m1/s1 |
| InChIKey | XQLURFWATPTMSW-RHPSINQUSA-N |
| XLogP | 5.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|