C22H36O4SSi — CID 10432506
(E,3S)-8-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-6-enal (PubChem CID 10432506) has the molecular formula C22H36O4SSi and a molecular weight of 424.68 g/mol. Its IUPAC name is (E,3S)-8-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-6-enal.
| Compound Name | (E,3S)-8-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-6-enal |
|---|---|
| PubChem CID | 10432506 |
| Molecular Formula | C22H36O4SSi |
| Molecular Weight | 424.68 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | (E,3S)-8-(benzenesulfonyl)-3-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyloct-6-enal |
| SMILES | CC(C)(C=O)[C@H](CC/C=C/CS(=O)(=O)c1ccccc1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H36O4SSi/c1-21(2,3)28(6,7)26-20(22(4,5)18-23)16-12-9-13-17-27(24,25)19-14-10-8-11-15-19/h8-11,13-15,18,20H,12,16-17H2,1-7H3/b13-9+/t20-/m0/s1 |
| InChIKey | DJGHKJSZANAGDK-SQSZOCELSA-N |
| XLogP | 5.41 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.68 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|