C28H34O3SSi — CID 10906935
(3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanal (PubChem CID 10906935) has the molecular formula C28H34O3SSi and a molecular weight of 478.73 g/mol. Its IUPAC name is (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanal.
| Compound Name | (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanal |
|---|---|
| PubChem CID | 10906935 |
| Molecular Formula | C28H34O3SSi |
| Molecular Weight | 478.73 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | (3S,4S)-5-(benzenesulfinyl)-3-[tert-butyl(diphenyl)silyl]oxy-4-methylpentanal |
| SMILES | C[C@H](CS(=O)c1ccccc1)[C@H](CC=O)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H34O3SSi/c1-23(22-32(30)24-14-8-5-9-15-24)27(20-21-29)31-33(28(2,3)4,25-16-10-6-11-17-25)26-18-12-7-13-19-26/h5-19,21,23,27H,20,22H2,1-4H3/t23-,27+,32?/m1/s1 |
| InChIKey | ADBCSUMMFJAJOK-ZBMYXVKESA-N |
| XLogP | 4.96 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.73 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|