C30H38O3SSi — CID 10929270
[(E,2R,3R)-1-(benzenesulfonyl)-2,4-dimethylhex-4-en-3-yl]oxy-tert-butyl-diphenylsilane (PubChem CID 10929270) has the molecular formula C30H38O3SSi and a molecular weight of 506.78 g/mol. Its IUPAC name is [(E,2R,3R)-1-(benzenesulfonyl)-2,4-dimethylhex-4-en-3-yl]oxy-tert-butyl-diphenylsilane.
| Compound Name | [(E,2R,3R)-1-(benzenesulfonyl)-2,4-dimethylhex-4-en-3-yl]oxy-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 10929270 |
| Molecular Formula | C30H38O3SSi |
| Molecular Weight | 506.78 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | [(E,2R,3R)-1-(benzenesulfonyl)-2,4-dimethylhex-4-en-3-yl]oxy-tert-butyl-diphenylsilane |
| SMILES | C/C=C(\C)[C@H](O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H](C)CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C30H38O3SSi/c1-7-24(2)29(25(3)23-34(31,32)26-17-11-8-12-18-26)33-35(30(4,5)6,27-19-13-9-14-20-27)28-21-15-10-16-22-28/h7-22,25,29H,23H2,1-6H3/b24-7+/t25-,29-/m0/s1 |
| InChIKey | CCJNTVWBUAZREP-VXVAISENSA-N |
| XLogP | 6.01 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.78 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|