C28H34O2SSi — CID 10950647
5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-phenylsulfanylpentanal (PubChem CID 10950647) has the molecular formula C28H34O2SSi and a molecular weight of 462.73 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-phenylsulfanylpentanal.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-phenylsulfanylpentanal |
|---|---|
| PubChem CID | 10950647 |
| Molecular Formula | C28H34O2SSi |
| Molecular Weight | 462.73 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxy-2-methyl-2-phenylsulfanylpentanal |
| SMILES | CC(C=O)(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)Sc1ccccc1 |
| InChI | InChI=1S/C28H34O2SSi/c1-27(2,3)32(25-17-10-6-11-18-25,26-19-12-7-13-20-26)30-22-14-21-28(4,23-29)31-24-15-8-5-9-16-24/h5-13,15-20,23H,14,21-22H2,1-4H3 |
| InChIKey | OTUXDGLMUKTIOY-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.73 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|