C22H36O2SSi — CID 10023459
(Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-phenylsulfanylhept-5-enal (PubChem CID 10023459) has the molecular formula C22H36O2SSi and a molecular weight of 392.68 g/mol. Its IUPAC name is (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-phenylsulfanylhept-5-enal.
| Compound Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-phenylsulfanylhept-5-enal |
|---|---|
| PubChem CID | 10023459 |
| Molecular Formula | C22H36O2SSi |
| Molecular Weight | 392.68 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | (Z,3S)-3-[tert-butyl(dimethyl)silyl]oxy-2,2,6-trimethyl-7-phenylsulfanylhept-5-enal |
| SMILES | C/C(=C/C[C@H](O[Si](C)(C)C(C)(C)C)C(C)(C)C=O)CSc1ccccc1 |
| InChI | InChI=1S/C22H36O2SSi/c1-18(16-25-19-12-10-9-11-13-19)14-15-20(22(5,6)17-23)24-26(7,8)21(2,3)4/h9-14,17,20H,15-16H2,1-8H3/b18-14-/t20-/m0/s1 |
| InChIKey | GTSYRMGFDJWKTJ-BXWQOUMASA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.68 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|