C19H32O3SSi — CID 10067638
S-phenyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanethioate (PubChem CID 10067638) has the molecular formula C19H32O3SSi and a molecular weight of 368.62 g/mol. Its IUPAC name is S-phenyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanethioate.
| Compound Name | S-phenyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanethioate |
|---|---|
| PubChem CID | 10067638 |
| Molecular Formula | C19H32O3SSi |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | S-phenyl (2S,3R)-2-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-4,4-dimethylpentanethioate |
| SMILES | CC(C)(C)[C@@H](O)[C@H](O[Si](C)(C)C(C)(C)C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C19H32O3SSi/c1-18(2,3)16(20)15(22-24(7,8)19(4,5)6)17(21)23-14-12-10-9-11-13-14/h9-13,15-16,20H,1-8H3/t15-,16-/m0/s1 |
| InChIKey | FAOGLQKABCKPCF-HOTGVXAUSA-N |
| XLogP | 5.10 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|