C20H34O3SSi — CID 134970336
S-phenyl (2R,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhexanethioate (PubChem CID 134970336) has the molecular formula C20H34O3SSi and a molecular weight of 382.64 g/mol. Its IUPAC name is S-phenyl (2R,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhexanethioate.
| Compound Name | S-phenyl (2R,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhexanethioate |
|---|---|
| PubChem CID | 134970336 |
| Molecular Formula | C20H34O3SSi |
| Molecular Weight | 382.64 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | S-phenyl (2R,3S,4R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2,4-dimethylhexanethioate |
| SMILES | C[C@H]([C@H](O)[C@@H](C)C(=O)Sc1ccccc1)[C@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H34O3SSi/c1-14(16(3)23-25(7,8)20(4,5)6)18(21)15(2)19(22)24-17-12-10-9-11-13-17/h9-16,18,21H,1-8H3/t14-,15+,16-,18-/m0/s1 |
| InChIKey | RRAFTUNWACWYDJ-DFGXFYAUSA-N |
| XLogP | 5.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|