C13H18O2S — CID 15091694
S-phenyl (2R,3S)-3-hydroxy-2-methylhexanethioate (PubChem CID 15091694) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is S-phenyl (2R,3S)-3-hydroxy-2-methylhexanethioate.
| Compound Name | S-phenyl (2R,3S)-3-hydroxy-2-methylhexanethioate |
|---|---|
| PubChem CID | 15091694 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | S-phenyl (2R,3S)-3-hydroxy-2-methylhexanethioate |
| SMILES | CCC[C@H](O)[C@@H](C)C(=O)Sc1ccccc1 |
| InChI | InChI=1S/C13H18O2S/c1-3-7-12(14)10(2)13(15)16-11-8-5-4-6-9-11/h4-6,8-10,12,14H,3,7H2,1-2H3/t10-,12+/m1/s1 |
| InChIKey | QBSJFSVUWBCCRM-PWSUYJOCSA-N |
| XLogP | 3.10 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|