C13H16F2O2S — CID 102533773
S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-methylhexanethioate (PubChem CID 102533773) has the molecular formula C13H16F2O2S and a molecular weight of 274.33 g/mol. Its IUPAC name is S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-methylhexanethioate.
| Compound Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-methylhexanethioate |
|---|---|
| PubChem CID | 102533773 |
| Molecular Formula | C13H16F2O2S |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | S-(2-fluorophenyl) (2S,3S)-2-fluoro-3-hydroxy-5-methylhexanethioate |
| SMILES | CC(C)C[C@H](O)[C@H](F)C(=O)Sc1ccccc1F |
| InChI | InChI=1S/C13H16F2O2S/c1-8(2)7-10(16)12(15)13(17)18-11-6-4-3-5-9(11)14/h3-6,8,10,12,16H,7H2,1-2H3/t10-,12-/m0/s1 |
| InChIKey | HBXSCPZFTMEJRF-JQWIXIFHSA-N |
| XLogP | 3.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|