C13H15F3O2S — CID 19902771
4-hydroxy-6-(2,4,5-trifluoro-3-methylphenyl)sulfanylhexan-2-one (PubChem CID 19902771) has the molecular formula C13H15F3O2S and a molecular weight of 292.32 g/mol. Its IUPAC name is 4-hydroxy-6-(2,4,5-trifluoro-3-methylphenyl)sulfanylhexan-2-one.
| Compound Name | 4-hydroxy-6-(2,4,5-trifluoro-3-methylphenyl)sulfanylhexan-2-one |
|---|---|
| PubChem CID | 19902771 |
| Molecular Formula | C13H15F3O2S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 4-hydroxy-6-(2,4,5-trifluoro-3-methylphenyl)sulfanylhexan-2-one |
| SMILES | CC(=O)CC(O)CCSc1cc(F)c(F)c(C)c1F |
| InChI | InChI=1S/C13H15F3O2S/c1-7(17)5-9(18)3-4-19-11-6-10(14)12(15)8(2)13(11)16/h6,9,18H,3-5H2,1-2H3 |
| InChIKey | HWNAWJQBLACWFA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|