C17H15F3INO2S — CID 121391149
3-(3-hydroxybutylsulfanyl)-4-iodo-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 121391149) has the molecular formula C17H15F3INO2S and a molecular weight of 481.28 g/mol. Its IUPAC name is 3-(3-hydroxybutylsulfanyl)-4-iodo-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-(3-hydroxybutylsulfanyl)-4-iodo-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 121391149 |
| Molecular Formula | C17H15F3INO2S |
| Molecular Weight | 481.28 g/mol |
| Exact Mass | 480.98 |
| IUPAC Name | 3-(3-hydroxybutylsulfanyl)-4-iodo-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(O)CCSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1I |
| InChI | InChI=1S/C17H15F3INO2S/c1-9(23)4-5-25-15-6-10(2-3-14(15)21)17(24)22-11-7-12(18)16(20)13(19)8-11/h2-3,6-9,23H,4-5H2,1H3,(H,22,24) |
| InChIKey | MEPAGFLRTDDXDF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.28 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|