C17H15F4NO2S — CID 121364144
4-fluoro-3-(4-hydroxybutylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 121364144) has the molecular formula C17H15F4NO2S and a molecular weight of 373.37 g/mol. Its IUPAC name is 4-fluoro-3-(4-hydroxybutylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-fluoro-3-(4-hydroxybutylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 121364144 |
| Molecular Formula | C17H15F4NO2S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | 4-fluoro-3-(4-hydroxybutylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(F)c(SCCCCO)c1 |
| InChI | InChI=1S/C17H15F4NO2S/c18-12-4-3-10(7-15(12)25-6-2-1-5-23)17(24)22-11-8-13(19)16(21)14(20)9-11/h3-4,7-9,23H,1-2,5-6H2,(H,22,24) |
| InChIKey | RDOYXVZGVRGWPF-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|