C22H23ClF3NO2S — CID 130425065
4-chloro-3-[1-(3-hydroxypropyl)cyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425065) has the molecular formula C22H23ClF3NO2S and a molecular weight of 457.95 g/mol. Its IUPAC name is 4-chloro-3-[1-(3-hydroxypropyl)cyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[1-(3-hydroxypropyl)cyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425065 |
| Molecular Formula | C22H23ClF3NO2S |
| Molecular Weight | 457.95 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | 4-chloro-3-[1-(3-hydroxypropyl)cyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2(CCCO)CCCCC2)c1 |
| InChI | InChI=1S/C22H23ClF3NO2S/c23-16-6-5-14(21(29)27-15-12-17(24)20(26)18(25)13-15)11-19(16)30-22(9-4-10-28)7-2-1-3-8-22/h5-6,11-13,28H,1-4,7-10H2,(H,27,29) |
| InChIKey | LMKAKPOIWIYPAB-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.95 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|