C20H19ClF3NO2S — CID 130425070
4-chloro-3-(4-hydroxycycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130425070) has the molecular formula C20H19ClF3NO2S and a molecular weight of 429.89 g/mol. Its IUPAC name is 4-chloro-3-(4-hydroxycycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(4-hydroxycycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130425070 |
| Molecular Formula | C20H19ClF3NO2S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 4-chloro-3-(4-hydroxycycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2CCCC(O)CC2)c1 |
| InChI | InChI=1S/C20H19ClF3NO2S/c21-15-7-4-11(8-18(15)28-14-3-1-2-13(26)5-6-14)20(27)25-12-9-16(22)19(24)17(23)10-12/h4,7-10,13-14,26H,1-3,5-6H2,(H,25,27) |
| InChIKey | ABBCAJVANGINNZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|