C23H29ClF3NO2S — CID 145366626
4-chloro-3-[(3R)-3-hydroxycyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane;propane (PubChem CID 145366626) has the molecular formula C23H29ClF3NO2S and a molecular weight of 476.00 g/mol. Its IUPAC name is 4-chloro-3-[(3R)-3-hydroxycyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane;propane.
| Compound Name | 4-chloro-3-[(3R)-3-hydroxycyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane;propane |
|---|---|
| PubChem CID | 145366626 |
| Molecular Formula | C23H29ClF3NO2S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-chloro-3-[(3R)-3-hydroxycyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane;propane |
| SMILES | CC.CCC.O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2CC[C@@H](O)C2)c1 |
| InChI | InChI=1S/C18H15ClF3NO2S.C3H8.C2H6/c19-13-4-1-9(5-16(13)26-12-3-2-11(24)8-12)18(25)23-10-6-14(20)17(22)15(21)7-10;1-3-2;1-2/h1,4-7,11-12,24H,2-3,8H2,(H,23,25);3H2,1-2H3;1-2H3/t11-,12?;;/m1../s1 |
| InChIKey | GZKVKAPLYXELJG-HLQRPDAISA-N |
| XLogP | 7.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|