C21H19ClF3NO2S — CID 130401598
4-chloro-3-[(8-hydroxy-3-bicyclo[3.2.1]octanyl)sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130401598) has the molecular formula C21H19ClF3NO2S and a molecular weight of 441.90 g/mol. Its IUPAC name is 4-chloro-3-[(8-hydroxy-3-bicyclo[3.2.1]octanyl)sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(8-hydroxy-3-bicyclo[3.2.1]octanyl)sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130401598 |
| Molecular Formula | C21H19ClF3NO2S |
| Molecular Weight | 441.90 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | 4-chloro-3-[(8-hydroxy-3-bicyclo[3.2.1]octanyl)sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2CC3CCC(C2)C3O)c1 |
| InChI | InChI=1S/C21H19ClF3NO2S/c22-15-4-3-12(21(28)26-13-8-16(23)19(25)17(24)9-13)7-18(15)29-14-5-10-1-2-11(6-14)20(10)27/h3-4,7-11,14,20,27H,1-2,5-6H2,(H,26,28) |
| InChIKey | MEWATDNLPJDKAZ-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.90 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|