C19H19ClFNOS — CID 145366635
4-chloro-3-cyclohexylsulfanyl-N-(3-fluorophenyl)benzamide (PubChem CID 145366635) has the molecular formula C19H19ClFNOS and a molecular weight of 363.89 g/mol. Its IUPAC name is 4-chloro-3-cyclohexylsulfanyl-N-(3-fluorophenyl)benzamide.
| Compound Name | 4-chloro-3-cyclohexylsulfanyl-N-(3-fluorophenyl)benzamide |
|---|---|
| PubChem CID | 145366635 |
| Molecular Formula | C19H19ClFNOS |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.09 |
| IUPAC Name | 4-chloro-3-cyclohexylsulfanyl-N-(3-fluorophenyl)benzamide |
| SMILES | O=C(Nc1cccc(F)c1)c1ccc(Cl)c(SC2CCCCC2)c1 |
| InChI | InChI=1S/C19H19ClFNOS/c20-17-10-9-13(11-18(17)24-16-7-2-1-3-8-16)19(23)22-15-6-4-5-14(21)12-15/h4-6,9-12,16H,1-3,7-8H2,(H,22,23) |
| InChIKey | NSGREJURSDWGHG-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |