C19H15ClF3NO3S — CID 147382689
4-chloro-3-(7-oxooxepan-3-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 147382689) has the molecular formula C19H15ClF3NO3S and a molecular weight of 429.85 g/mol. Its IUPAC name is 4-chloro-3-(7-oxooxepan-3-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(7-oxooxepan-3-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 147382689 |
| Molecular Formula | C19H15ClF3NO3S |
| Molecular Weight | 429.85 g/mol |
| Exact Mass | 429.04 |
| IUPAC Name | 4-chloro-3-(7-oxooxepan-3-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C1CCCC(Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CO1 |
| InChI | InChI=1S/C19H15ClF3NO3S/c20-13-5-4-10(6-16(13)28-12-2-1-3-17(25)27-9-12)19(26)24-11-7-14(21)18(23)15(22)8-11/h4-8,12H,1-3,9H2,(H,24,26) |
| InChIKey | DLHDJPQHIMCTIX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.85 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|