C23H23ClF3NO3S — CID 130402316
4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxyethyl)-3-bicyclo[3.2.1]octanyl]sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130402316) has the molecular formula C23H23ClF3NO3S and a molecular weight of 485.96 g/mol. Its IUPAC name is 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxyethyl)-3-bicyclo[3.2.1]octanyl]sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxyethyl)-3-bicyclo[3.2.1]octanyl]sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130402316 |
| Molecular Formula | C23H23ClF3NO3S |
| Molecular Weight | 485.96 g/mol |
| Exact Mass | 485.10 |
| IUPAC Name | 4-chloro-3-[[(5S)-8-hydroxy-8-(2-hydroxyethyl)-3-bicyclo[3.2.1]octanyl]sulfanyl]-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2CC3CC[C@@H](C2)C3(O)CCO)c1 |
| InChI | InChI=1S/C23H23ClF3NO3S/c24-17-4-1-12(22(30)28-15-10-18(25)21(27)19(26)11-15)7-20(17)32-16-8-13-2-3-14(9-16)23(13,31)5-6-29/h1,4,7,10-11,13-14,16,29,31H,2-3,5-6,8-9H2,(H,28,30)/t13-,14?,16?,23?/m0/s1 |
| InChIKey | PNORBDFIIYZFPO-DHLRTPTCSA-N |
| XLogP | 5.40 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.96 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|