C19H17ClF3NO3S — CID 130397361
4-chloro-3-[(3S,5R)-3,5-dihydroxycyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397361) has the molecular formula C19H17ClF3NO3S and a molecular weight of 431.86 g/mol. Its IUPAC name is 4-chloro-3-[(3S,5R)-3,5-dihydroxycyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[(3S,5R)-3,5-dihydroxycyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397361 |
| Molecular Formula | C19H17ClF3NO3S |
| Molecular Weight | 431.86 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 4-chloro-3-[(3S,5R)-3,5-dihydroxycyclohexyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SC2C[C@@H](O)C[C@@H](O)C2)c1 |
| InChI | InChI=1S/C19H17ClF3NO3S/c20-14-2-1-9(3-17(14)28-13-7-11(25)6-12(26)8-13)19(27)24-10-4-15(21)18(23)16(22)5-10/h1-5,11-13,25-26H,6-8H2,(H,24,27)/t11-,12+,13? |
| InChIKey | ZPEUZXWHEBFPBN-FUNVUKJBSA-N |
| XLogP | 4.38 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.86 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|