C23H27ClF3NO2S — CID 145366742
4-chloro-3-(4-hydroxy-5-methylcycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane (PubChem CID 145366742) has the molecular formula C23H27ClF3NO2S and a molecular weight of 473.99 g/mol. Its IUPAC name is 4-chloro-3-(4-hydroxy-5-methylcycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane.
| Compound Name | 4-chloro-3-(4-hydroxy-5-methylcycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane |
|---|---|
| PubChem CID | 145366742 |
| Molecular Formula | C23H27ClF3NO2S |
| Molecular Weight | 473.99 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | 4-chloro-3-(4-hydroxy-5-methylcycloheptyl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethane |
| SMILES | CC.CC1CCC(Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)CCC1O |
| InChI | InChI=1S/C21H21ClF3NO2S.C2H6/c1-11-2-4-14(5-7-18(11)27)29-19-8-12(3-6-15(19)22)21(28)26-13-9-16(23)20(25)17(24)10-13;1-2/h3,6,8-11,14,18,27H,2,4-5,7H2,1H3,(H,26,28);1-2H3 |
| InChIKey | WDDWXHVUQFXPAQ-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.99 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|