C23H26ClF3N2OS — CID 167246494
3-[2-(3-amino-2-methylpropyl)-5-methylcyclopentyl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167246494) has the molecular formula C23H26ClF3N2OS and a molecular weight of 470.99 g/mol. Its IUPAC name is 3-[2-(3-amino-2-methylpropyl)-5-methylcyclopentyl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 3-[2-(3-amino-2-methylpropyl)-5-methylcyclopentyl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167246494 |
| Molecular Formula | C23H26ClF3N2OS |
| Molecular Weight | 470.99 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-[2-(3-amino-2-methylpropyl)-5-methylcyclopentyl]sulfanyl-4-chloro-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(CN)CC1CCC(C)C1Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H26ClF3N2OS/c1-12(11-28)7-14-4-3-13(2)22(14)31-20-8-15(5-6-17(20)24)23(30)29-16-9-18(25)21(27)19(26)10-16/h5-6,8-10,12-14,22H,3-4,7,11,28H2,1-2H3,(H,29,30) |
| InChIKey | NAOHHCKQRIPCTB-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.99 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|