C28H34ClF3N2O2S — CID 145366747
4-chloro-3-[2,3-dimethyl-5-[(3E)-2-methyl-3-[(2-methylpropan-2-yl)oxyimino]propyl]cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145366747) has the molecular formula C28H34ClF3N2O2S and a molecular weight of 555.11 g/mol. Its IUPAC name is 4-chloro-3-[2,3-dimethyl-5-[(3E)-2-methyl-3-[(2-methylpropan-2-yl)oxyimino]propyl]cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2,3-dimethyl-5-[(3E)-2-methyl-3-[(2-methylpropan-2-yl)oxyimino]propyl]cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145366747 |
| Molecular Formula | C28H34ClF3N2O2S |
| Molecular Weight | 555.11 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 4-chloro-3-[2,3-dimethyl-5-[(3E)-2-methyl-3-[(2-methylpropan-2-yl)oxyimino]propyl]cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(/C=N/OC(C)(C)C)CC1CC(C)C(C)C1Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C28H34ClF3N2O2S/c1-15(14-33-36-28(4,5)6)9-19-10-16(2)17(3)26(19)37-24-11-18(7-8-21(24)29)27(35)34-20-12-22(30)25(32)23(31)13-20/h7-8,11-17,19,26H,9-10H2,1-6H3,(H,34,35)/b33-14+ |
| InChIKey | USJFKTOSLKRVLR-ZHSUKTGHSA-N |
| XLogP | 8.59 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.11 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|