C26H28ClF3N2O2S — CID 167247154
4-chloro-3-[5-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-2,3-dimethylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167247154) has the molecular formula C26H28ClF3N2O2S and a molecular weight of 525.04 g/mol. Its IUPAC name is 4-chloro-3-[5-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-2,3-dimethylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[5-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-2,3-dimethylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167247154 |
| Molecular Formula | C26H28ClF3N2O2S |
| Molecular Weight | 525.04 g/mol |
| Exact Mass | 524.15 |
| IUPAC Name | 4-chloro-3-[5-[(3,5-dimethyl-4H-1,2-oxazol-5-yl)methyl]-2,3-dimethylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC1=NOC(C)(CC2CC(C)C(C)C2Sc2cc(C(=O)Nc3cc(F)c(F)c(F)c3)ccc2Cl)C1 |
| InChI | InChI=1S/C26H28ClF3N2O2S/c1-13-7-17(12-26(4)11-14(2)32-34-26)24(15(13)3)35-22-8-16(5-6-19(22)27)25(33)31-18-9-20(28)23(30)21(29)10-18/h5-6,8-10,13,15,17,24H,7,11-12H2,1-4H3,(H,31,33) |
| InChIKey | ZCDRMJHZEVGANV-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.04 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|