C30H29ClF3NO2S — CID 145366686
4-chloro-3-[2-(2-hydroxypropyl)-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethynylbenzene (PubChem CID 145366686) has the molecular formula C30H29ClF3NO2S and a molecular weight of 560.08 g/mol. Its IUPAC name is 4-chloro-3-[2-(2-hydroxypropyl)-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethynylbenzene.
| Compound Name | 4-chloro-3-[2-(2-hydroxypropyl)-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethynylbenzene |
|---|---|
| PubChem CID | 145366686 |
| Molecular Formula | C30H29ClF3NO2S |
| Molecular Weight | 560.08 g/mol |
| Exact Mass | 559.16 |
| IUPAC Name | 4-chloro-3-[2-(2-hydroxypropyl)-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;ethynylbenzene |
| SMILES | C#Cc1ccccc1.CC(O)CC1CCC(C)C1Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H23ClF3NO2S.C8H6/c1-11-3-4-13(7-12(2)28)21(11)30-19-8-14(5-6-16(19)23)22(29)27-15-9-17(24)20(26)18(25)10-15;1-2-8-6-4-3-5-7-8/h5-6,8-13,21,28H,3-4,7H2,1-2H3,(H,27,29);1,3-7H |
| InChIKey | KKPSHDSHDUUCQI-UHFFFAOYSA-N |
| XLogP | 7.96 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.08 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|