C25H30ClF3N2OS — CID 145366547
4-chloro-3-[2-[3-(dimethylamino)-2-methylpropyl]-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145366547) has the molecular formula C25H30ClF3N2OS and a molecular weight of 499.04 g/mol. Its IUPAC name is 4-chloro-3-[2-[3-(dimethylamino)-2-methylpropyl]-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2-[3-(dimethylamino)-2-methylpropyl]-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145366547 |
| Molecular Formula | C25H30ClF3N2OS |
| Molecular Weight | 499.04 g/mol |
| Exact Mass | 498.17 |
| IUPAC Name | 4-chloro-3-[2-[3-(dimethylamino)-2-methylpropyl]-5-methylcyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(CC1CCC(C)C1Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl)CN(C)C |
| InChI | InChI=1S/C25H30ClF3N2OS/c1-14(13-31(3)4)9-16-6-5-15(2)24(16)33-22-10-17(7-8-19(22)26)25(32)30-18-11-20(27)23(29)21(28)12-18/h7-8,10-12,14-16,24H,5-6,9,13H2,1-4H3,(H,30,32) |
| InChIKey | DPONZOIHCLJSBK-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.04 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|