C24H25ClF3NOS — CID 167247023
4-chloro-3-[2-methyl-5-(2-methylbut-3-enyl)cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167247023) has the molecular formula C24H25ClF3NOS and a molecular weight of 467.98 g/mol. Its IUPAC name is 4-chloro-3-[2-methyl-5-(2-methylbut-3-enyl)cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2-methyl-5-(2-methylbut-3-enyl)cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167247023 |
| Molecular Formula | C24H25ClF3NOS |
| Molecular Weight | 467.98 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 4-chloro-3-[2-methyl-5-(2-methylbut-3-enyl)cyclopentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | C=CC(C)CC1CCC(C)C1Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C24H25ClF3NOS/c1-4-13(2)9-15-6-5-14(3)23(15)31-21-10-16(7-8-18(21)25)24(30)29-17-11-19(26)22(28)20(27)12-17/h4,7-8,10-15,23H,1,5-6,9H2,2-3H3,(H,29,30) |
| InChIKey | MBKJCVOPCRAIDN-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.98 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|