C20H22ClF3N2OS — CID 145366739
4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-methylpent-4-en-1-amine (PubChem CID 145366739) has the molecular formula C20H22ClF3N2OS and a molecular weight of 430.92 g/mol. Its IUPAC name is 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-methylpent-4-en-1-amine.
| Compound Name | 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-methylpent-4-en-1-amine |
|---|---|
| PubChem CID | 145366739 |
| Molecular Formula | C20H22ClF3N2OS |
| Molecular Weight | 430.92 g/mol |
| Exact Mass | 430.11 |
| IUPAC Name | 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;2-methylpent-4-en-1-amine |
| SMILES | C=CCC(C)CN.CSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C14H9ClF3NOS.C6H13N/c1-21-12-4-7(2-3-9(12)15)14(20)19-8-5-10(16)13(18)11(17)6-8;1-3-4-6(2)5-7/h2-6H,1H3,(H,19,20);3,6H,1,4-5,7H2,2H3 |
| InChIKey | NWWAJOHHQWSJQY-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.92 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|