C23H29ClF3NO2S — CID 145366809
4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;hex-5-en-1-ol;propane (PubChem CID 145366809) has the molecular formula C23H29ClF3NO2S and a molecular weight of 476.00 g/mol. Its IUPAC name is 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;hex-5-en-1-ol;propane.
| Compound Name | 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;hex-5-en-1-ol;propane |
|---|---|
| PubChem CID | 145366809 |
| Molecular Formula | C23H29ClF3NO2S |
| Molecular Weight | 476.00 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | 4-chloro-3-methylsulfanyl-N-(3,4,5-trifluorophenyl)benzamide;hex-5-en-1-ol;propane |
| SMILES | C=CCCCCO.CCC.CSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C14H9ClF3NOS.C6H12O.C3H8/c1-21-12-4-7(2-3-9(12)15)14(20)19-8-5-10(16)13(18)11(17)6-8;1-2-3-4-5-6-7;1-3-2/h2-6H,1H3,(H,19,20);2,7H,1,3-6H2;3H2,1-2H3 |
| InChIKey | YQPKJJSDKIJOTA-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.00 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|