C23H28ClF3N2O2S — CID 145366699
4-chloro-3-[2-(3-hydroxypropyl)-4-methyl-5-(methylamino)pentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 145366699) has the molecular formula C23H28ClF3N2O2S and a molecular weight of 489.00 g/mol. Its IUPAC name is 4-chloro-3-[2-(3-hydroxypropyl)-4-methyl-5-(methylamino)pentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[2-(3-hydroxypropyl)-4-methyl-5-(methylamino)pentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 145366699 |
| Molecular Formula | C23H28ClF3N2O2S |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | 4-chloro-3-[2-(3-hydroxypropyl)-4-methyl-5-(methylamino)pentyl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CNCC(C)CC(CCCO)CSc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C23H28ClF3N2O2S/c1-14(12-28-2)8-15(4-3-7-30)13-32-21-9-16(5-6-18(21)24)23(31)29-17-10-19(25)22(27)20(26)11-17/h5-6,9-11,14-15,28,30H,3-4,7-8,12-13H2,1-2H3,(H,29,31) |
| InChIKey | CQCYNZFPNVDYHQ-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.00 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|