C24H29ClF3NO2S — CID 167247033
4-chloro-3-(1-hydroxy-2,6,7-trimethyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167247033) has the molecular formula C24H29ClF3NO2S and a molecular weight of 488.02 g/mol. Its IUPAC name is 4-chloro-3-(1-hydroxy-2,6,7-trimethyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(1-hydroxy-2,6,7-trimethyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167247033 |
| Molecular Formula | C24H29ClF3NO2S |
| Molecular Weight | 488.02 g/mol |
| Exact Mass | 487.16 |
| IUPAC Name | 4-chloro-3-(1-hydroxy-2,6,7-trimethyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CC(CO)CC(CC(C)C(C)C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C24H29ClF3NO2S/c1-13(2)15(4)8-18(7-14(3)12-30)32-22-9-16(5-6-19(22)25)24(31)29-17-10-20(26)23(28)21(27)11-17/h5-6,9-11,13-15,18,30H,7-8,12H2,1-4H3,(H,29,31) |
| InChIKey | TWWDQRYDNLEIFC-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.02 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|