C27H34ClF3N2O2S — CID 167246762
4-chloro-3-(5-methyl-6-morpholin-4-yl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167246762) has the molecular formula C27H34ClF3N2O2S and a molecular weight of 543.10 g/mol. Its IUPAC name is 4-chloro-3-(5-methyl-6-morpholin-4-yl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(5-methyl-6-morpholin-4-yl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167246762 |
| Molecular Formula | C27H34ClF3N2O2S |
| Molecular Weight | 543.10 g/mol |
| Exact Mass | 542.20 |
| IUPAC Name | 4-chloro-3-(5-methyl-6-morpholin-4-yl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCCC(CC(C)CN1CCOCC1)C(C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C27H34ClF3N2O2S/c1-4-5-19(12-17(2)16-33-8-10-35-11-9-33)18(3)36-25-13-20(6-7-22(25)28)27(34)32-21-14-23(29)26(31)24(30)15-21/h6-7,13-15,17-19H,4-5,8-12,16H2,1-3H3,(H,32,34) |
| InChIKey | BVZBTYURWRNHDA-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.10 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|