C26H34ClF3N2O3S — CID 145366620
4-chloro-3-(5-methyl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;methyl N-methylcarbamate (PubChem CID 145366620) has the molecular formula C26H34ClF3N2O3S and a molecular weight of 547.08 g/mol. Its IUPAC name is 4-chloro-3-(5-methyl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;methyl N-methylcarbamate.
| Compound Name | 4-chloro-3-(5-methyl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;methyl N-methylcarbamate |
|---|---|
| PubChem CID | 145366620 |
| Molecular Formula | C26H34ClF3N2O3S |
| Molecular Weight | 547.08 g/mol |
| Exact Mass | 546.19 |
| IUPAC Name | 4-chloro-3-(5-methyl-3-propylhexan-2-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide;methyl N-methylcarbamate |
| SMILES | CCCC(CC(C)C)C(C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl.CNC(=O)OC |
| InChI | InChI=1S/C23H27ClF3NOS.C3H7NO2/c1-5-6-15(9-13(2)3)14(4)30-21-10-16(7-8-18(21)24)23(29)28-17-11-19(25)22(27)20(26)12-17;1-4-3(5)6-2/h7-8,10-15H,5-6,9H2,1-4H3,(H,28,29);1-2H3,(H,4,5) |
| InChIKey | YGRRQEPREOTEIH-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.08 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|