C25H27ClF3N3OS — CID 167247374
4-chloro-3-[5-(1H-imidazol-2-yl)-3-propylhexan-2-yl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167247374) has the molecular formula C25H27ClF3N3OS and a molecular weight of 510.03 g/mol. Its IUPAC name is 4-chloro-3-[5-(1H-imidazol-2-yl)-3-propylhexan-2-yl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-[5-(1H-imidazol-2-yl)-3-propylhexan-2-yl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167247374 |
| Molecular Formula | C25H27ClF3N3OS |
| Molecular Weight | 510.03 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | 4-chloro-3-[5-(1H-imidazol-2-yl)-3-propylhexan-2-yl]sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCCC(CC(C)c1ncc[nH]1)C(C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C25H27ClF3N3OS/c1-4-5-16(10-14(2)24-30-8-9-31-24)15(3)34-22-11-17(6-7-19(22)26)25(33)32-18-12-20(27)23(29)21(28)13-18/h6-9,11-16H,4-5,10H2,1-3H3,(H,30,31)(H,32,33) |
| InChIKey | AJMBULOITJZWBP-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.03 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|