C19H12ClF3N2OS — CID 130397502
4-chloro-3-(pyridin-3-ylmethylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130397502) has the molecular formula C19H12ClF3N2OS and a molecular weight of 408.83 g/mol. Its IUPAC name is 4-chloro-3-(pyridin-3-ylmethylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(pyridin-3-ylmethylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130397502 |
| Molecular Formula | C19H12ClF3N2OS |
| Molecular Weight | 408.83 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 4-chloro-3-(pyridin-3-ylmethylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)c1ccc(Cl)c(SCc2cccnc2)c1 |
| InChI | InChI=1S/C19H12ClF3N2OS/c20-14-4-3-12(6-17(14)27-10-11-2-1-5-24-9-11)19(26)25-13-7-15(21)18(23)16(22)8-13/h1-9H,10H2,(H,25,26) |
| InChIKey | FUYPJQGWENEQJS-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.83 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|