C20H21ClF3NOS — CID 130424951
4-chloro-3-(5-methylhexan-3-ylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 130424951) has the molecular formula C20H21ClF3NOS and a molecular weight of 415.91 g/mol. Its IUPAC name is 4-chloro-3-(5-methylhexan-3-ylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(5-methylhexan-3-ylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 130424951 |
| Molecular Formula | C20H21ClF3NOS |
| Molecular Weight | 415.91 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 4-chloro-3-(5-methylhexan-3-ylsulfanyl)-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCC(CC(C)C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C20H21ClF3NOS/c1-4-14(7-11(2)3)27-18-8-12(5-6-15(18)21)20(26)25-13-9-16(22)19(24)17(23)10-13/h5-6,8-11,14H,4,7H2,1-3H3,(H,25,26) |
| InChIKey | HFUCMBWCBDCWAX-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.91 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|