C22H25ClF3NO2S — CID 167246681
4-chloro-3-(6-hydroxy-2-methyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide (PubChem CID 167246681) has the molecular formula C22H25ClF3NO2S and a molecular weight of 459.96 g/mol. Its IUPAC name is 4-chloro-3-(6-hydroxy-2-methyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide.
| Compound Name | 4-chloro-3-(6-hydroxy-2-methyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
|---|---|
| PubChem CID | 167246681 |
| Molecular Formula | C22H25ClF3NO2S |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 4-chloro-3-(6-hydroxy-2-methyloctan-4-yl)sulfanyl-N-(3,4,5-trifluorophenyl)benzamide |
| SMILES | CCC(O)CC(CC(C)C)Sc1cc(C(=O)Nc2cc(F)c(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C22H25ClF3NO2S/c1-4-15(28)11-16(7-12(2)3)30-20-8-13(5-6-17(20)23)22(29)27-14-9-18(24)21(26)19(25)10-14/h5-6,8-10,12,15-16,28H,4,7,11H2,1-3H3,(H,27,29) |
| InChIKey | COLKTQVUQCWVPI-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|