C15H13ClF2N2OS — CID 167246710
4-chloro-N-(3,4-difluorophenyl)-3-(methylaminomethylsulfanyl)benzamide (PubChem CID 167246710) has the molecular formula C15H13ClF2N2OS and a molecular weight of 342.80 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluorophenyl)-3-(methylaminomethylsulfanyl)benzamide.
| Compound Name | 4-chloro-N-(3,4-difluorophenyl)-3-(methylaminomethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 167246710 |
| Molecular Formula | C15H13ClF2N2OS |
| Molecular Weight | 342.80 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | 4-chloro-N-(3,4-difluorophenyl)-3-(methylaminomethylsulfanyl)benzamide |
| SMILES | CNCSc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C15H13ClF2N2OS/c1-19-8-22-14-6-9(2-4-11(14)16)15(21)20-10-3-5-12(17)13(18)7-10/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | HJCHOSVCEWAFIC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.80 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|