C14H11ClF2N2OS — CID 79128069
2-(5-amino-2-chlorophenyl)sulfanyl-N-(3,4-difluorophenyl)acetamide (PubChem CID 79128069) has the molecular formula C14H11ClF2N2OS and a molecular weight of 328.77 g/mol. Its IUPAC name is 2-(5-amino-2-chlorophenyl)sulfanyl-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 79128069 |
| Molecular Formula | C14H11ClF2N2OS |
| Molecular Weight | 328.77 g/mol |
| Exact Mass | 328.02 |
| IUPAC Name | 2-(5-amino-2-chlorophenyl)sulfanyl-N-(3,4-difluorophenyl)acetamide |
| SMILES | Nc1ccc(Cl)c(SCC(=O)Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C14H11ClF2N2OS/c15-10-3-1-8(18)5-13(10)21-7-14(20)19-9-2-4-11(16)12(17)6-9/h1-6H,7,18H2,(H,19,20) |
| InChIKey | SVUXXYQFTVAVIE-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.77 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|