C13H11F2N3OS — CID 43301917
2-[(6-amino-3-pyridinyl)sulfanyl]-N-(3,4-difluorophenyl)acetamide (PubChem CID 43301917) has the molecular formula C13H11F2N3OS and a molecular weight of 295.31 g/mol. Its IUPAC name is 2-[(6-amino-3-pyridinyl)sulfanyl]-N-(3,4-difluorophenyl)acetamide.
| Compound Name | 2-[(6-amino-3-pyridinyl)sulfanyl]-N-(3,4-difluorophenyl)acetamide |
|---|---|
| PubChem CID | 43301917 |
| Molecular Formula | C13H11F2N3OS |
| Molecular Weight | 295.31 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | 2-[(6-amino-3-pyridinyl)sulfanyl]-N-(3,4-difluorophenyl)acetamide |
| SMILES | Nc1ccc(SCC(=O)Nc2ccc(F)c(F)c2)cn1 |
| InChI | InChI=1S/C13H11F2N3OS/c14-10-3-1-8(5-11(10)15)18-13(19)7-20-9-2-4-12(16)17-6-9/h1-6H,7H2,(H2,16,17)(H,18,19) |
| InChIKey | TUCFGENTDDHUQJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |