C20H18ClF2NO2S — CID 142538086
4-chloro-N-(3,4-difluorophenyl)-3-(3-hydroxy-3-prop-2-enylcyclobutyl)sulfanylbenzamide (PubChem CID 142538086) has the molecular formula C20H18ClF2NO2S and a molecular weight of 409.89 g/mol. Its IUPAC name is 4-chloro-N-(3,4-difluorophenyl)-3-(3-hydroxy-3-prop-2-enylcyclobutyl)sulfanylbenzamide.
| Compound Name | 4-chloro-N-(3,4-difluorophenyl)-3-(3-hydroxy-3-prop-2-enylcyclobutyl)sulfanylbenzamide |
|---|---|
| PubChem CID | 142538086 |
| Molecular Formula | C20H18ClF2NO2S |
| Molecular Weight | 409.89 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-chloro-N-(3,4-difluorophenyl)-3-(3-hydroxy-3-prop-2-enylcyclobutyl)sulfanylbenzamide |
| SMILES | C=CCC1(O)CC(Sc2cc(C(=O)Nc3ccc(F)c(F)c3)ccc2Cl)C1 |
| InChI | InChI=1S/C20H18ClF2NO2S/c1-2-7-20(26)10-14(11-20)27-18-8-12(3-5-15(18)21)19(25)24-13-4-6-16(22)17(23)9-13/h2-6,8-9,14,26H,1,7,10-11H2,(H,24,25) |
| InChIKey | AIDMNTRGPYOTBX-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.89 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|