C21H20F3NO2S — CID 121370673
3-(4-acetylcyclohexyl)sulfanyl-N-(3,4-difluorophenyl)-4-fluorobenzamide (PubChem CID 121370673) has the molecular formula C21H20F3NO2S and a molecular weight of 407.46 g/mol. Its IUPAC name is 3-(4-acetylcyclohexyl)sulfanyl-N-(3,4-difluorophenyl)-4-fluorobenzamide.
| Compound Name | 3-(4-acetylcyclohexyl)sulfanyl-N-(3,4-difluorophenyl)-4-fluorobenzamide |
|---|---|
| PubChem CID | 121370673 |
| Molecular Formula | C21H20F3NO2S |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 3-(4-acetylcyclohexyl)sulfanyl-N-(3,4-difluorophenyl)-4-fluorobenzamide |
| SMILES | CC(=O)C1CCC(Sc2cc(C(=O)Nc3ccc(F)c(F)c3)ccc2F)CC1 |
| InChI | InChI=1S/C21H20F3NO2S/c1-12(26)13-2-6-16(7-3-13)28-20-10-14(4-8-18(20)23)21(27)25-15-5-9-17(22)19(24)11-15/h4-5,8-11,13,16H,2-3,6-7H2,1H3,(H,25,27) |
| InChIKey | YLLORQHBHPRGRK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |