C20H21ClFNO2S — CID 121370731
N-(3-chloro-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfanyl-4-methylbenzamide (PubChem CID 121370731) has the molecular formula C20H21ClFNO2S and a molecular weight of 393.91 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfanyl-4-methylbenzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfanyl-4-methylbenzamide |
|---|---|
| PubChem CID | 121370731 |
| Molecular Formula | C20H21ClFNO2S |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-(4-hydroxycyclohexyl)sulfanyl-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1SC1CCC(O)CC1 |
| InChI | InChI=1S/C20H21ClFNO2S/c1-12-2-3-13(10-19(12)26-16-7-5-15(24)6-8-16)20(25)23-14-4-9-18(22)17(21)11-14/h2-4,9-11,15-16,24H,5-8H2,1H3,(H,23,25) |
| InChIKey | FQYBBTLAMSZAEI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |