C21H21ClFNOS — CID 121391197
N-(3-chloro-4-fluorophenyl)-3-cyclohexylsulfanyl-4-ethenylbenzamide (PubChem CID 121391197) has the molecular formula C21H21ClFNOS and a molecular weight of 389.92 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-cyclohexylsulfanyl-4-ethenylbenzamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-cyclohexylsulfanyl-4-ethenylbenzamide |
|---|---|
| PubChem CID | 121391197 |
| Molecular Formula | C21H21ClFNOS |
| Molecular Weight | 389.92 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-cyclohexylsulfanyl-4-ethenylbenzamide |
| SMILES | C=Cc1ccc(C(=O)Nc2ccc(F)c(Cl)c2)cc1SC1CCCCC1 |
| InChI | InChI=1S/C21H21ClFNOS/c1-2-14-8-9-15(12-20(14)26-17-6-4-3-5-7-17)21(25)24-16-10-11-19(23)18(22)13-16/h2,8-13,17H,1,3-7H2,(H,24,25) |
| InChIKey | SYBSFPBGJCUYNB-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.92 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |